Physicochemical Properties
| Molecular Formula | C10H13N5NA3O13P3 |
| Molecular Weight | 573.13 |
| Exact Mass | 572.941 |
| CAS # | 93919-41-6 |
| Related CAS # | dGTP;2564-35-4 |
| PubChem CID | 135705223 |
| Appearance | Colorless to light yellow liquid |
| LogP | 0.589 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 15 |
| Rotatable Bond Count | 8 |
| Heavy Atom Count | 34 |
| Complexity | 876 |
| Defined Atom Stereocenter Count | 3 |
| SMILES | O=C1N=C(N)NC2N([C@H]3C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O3)C=NC1=2.[Na] |
| InChi Key | IWGGLKOTEOCWQP-BIHLCPNHSA-K |
| InChi Code | InChI=1S/C10H16N5O13P3.3Na/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(26-6)2-25-30(21,22)28-31(23,24)27-29(18,19)20;;;/h3-6,16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,13,14,17);;;/q;3*+1/p-3/t4-,5+,6+;;;/m0.../s1 |
| Chemical Name | trisodium;[[[(2R,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] hydrogen phosphate |
| Synonyms | 2'-Deoxyguanosine-5'-triphosphate trisodium salt; dGTP trisodium salt; Deoxyguanosine triphosphate trisodium salt |
| HS Tariff Code | 2934.99.9001 |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| References |
[1]. The Ubiquitin Ligase TRIP12 Limits PARP1 Trapping and Constrains PARP Inhibitor Efficiency. Cell Rep. 2020 Aug 4;32(5):107985. |
Solubility Data
| Solubility (In Vitro) |
H2O : ~66.7 mg/mL (~116.3 mM) DMSO : < 1 mg/mL |
| Solubility (In Vivo) |
Solubility in Formulation 1: 100 mg/mL (174.48 mM) in PBS (add these co-solvents sequentially from left to right, and one by one), clear solution; with sonication.  (Please use freshly prepared in vivo formulations for optimal results.) |
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 1.7448 mL | 8.7240 mL | 17.4480 mL | |
| 5 mM | 0.3490 mL | 1.7448 mL | 3.4896 mL | |
| 10 mM | 0.1745 mL | 0.8724 mL | 1.7448 mL |