Physicochemical Properties
| Molecular Formula | C6H11FO4 |
| Molecular Weight | 166.1475 |
| Exact Mass | 166.064 |
| CAS # | 2089647-47-0 |
| PubChem CID | 44544736 |
| Appearance | White to off-white solid powder |
| Density | 1.42±0.1 g/cm3(Predicted) |
| Boiling Point | 323.7±42.0 °C(Predicted) |
| LogP | -1.1 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Heavy Atom Count | 11 |
| Complexity | 143 |
| Defined Atom Stereocenter Count | 4 |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H](C(O1)O)F)O)O |
| InChi Key | IRKXGKIPOMIQOD-ZZWDRFIYSA-N |
| InChi Code | InChI=1S/C6H11FO4/c1-2-4(8)5(9)3(7)6(10)11-2/h2-6,8-10H,1H3/t2-,3-,4+,5-,6?/m0/s1 |
| Chemical Name | (3S,4R,5S,6S)-3-fluoro-6-methyloxane-2,4,5-triol |
| HS Tariff Code | 2934.99.9001 |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| Targets |
The target of SGN-2FF is fucosylation (a post-translational modification process) [1] |
| ln Vitro |
SGN-2FF (2-Fluorofucose) is a fucosylated transcript that inhibits the production of afucosylated glycoproteins, including inducers, by depleting the fucosylation substrate GDP-fucose and directly inhibiting fucosyltransferase. Human T cells are inducibly activated by SGN-2FF [1]. SGN-2FF exhibited preclinical antitumor activity through multiple immune mechanisms in vitro [1] |
| ln Vivo |
SGN-2FF significantly retards tumor growth in a number of mice tumor models, demonstrating anti-tumor efficacy. In syngeneic animal tumor models, SGN-2FF enhances the vaccine's protective efficacy [1]. SGN-2FF demonstrated preclinical antitumor activity mediated by multiple immune mechanisms in vivo [1] |
| References |
[1]. Abstract DDT02-02: SGN-2FF: A novel small molecule inhibitor of fucosylation with preclinical antitumor activity through multiple immune mechanisms. Cancer Res 2017;77(13 Suppl). |
| Additional Infomation |
1. SGN-2FF is a novel small-molecule inhibitor of fucosylation, a post-translational modification involved in tumor progression and immune regulation [1] 2. Its antitumor effect is exerted through multiple immune-related mechanisms [1] 3. It has potential as a novel immunotherapeutic agent for cancer treatment [1] |
Solubility Data
| Solubility (In Vitro) |
DMSO : ~50 mg/mL (~300.93 mM) H2O : ~36.67 mg/mL (~220.70 mM) |
| Solubility (In Vivo) |
Solubility in Formulation 1: 50 mg/mL (300.93 mM) in PBS (add these co-solvents sequentially from left to right, and one by one), clear solution; with sonication. (Please use freshly prepared in vivo formulations for optimal results.) |
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 6.0187 mL | 30.0933 mL | 60.1866 mL | |
| 5 mM | 1.2037 mL | 6.0187 mL | 12.0373 mL | |
| 10 mM | 0.6019 mL | 3.0093 mL | 6.0187 mL |