RN486 (RN-486) is a novel, potent, reversible and selective BTK (Bruton's tyrosine kinase) inhibitor with potential anti-inflammatory activity. It inhibits BTK with an IC50 of 4 nM. RN486 exhibits strong in vivo anti-inflammatory and bone-protective effects in mouse CIA and rat adjuvant-induced arthritis (AIA) models. In the AIA model, RN486 inhibits both joint and systemic inflammation either alone or in combination with methotrexate, reducing both paw swelling and inflammatory markers in the blood.
Physicochemical Properties
| Molecular Formula | C35H35FN6O3 | |
| Molecular Weight | 606.69 | |
| Exact Mass | 606.275 | |
| CAS # | 1242156-23-5 | |
| Related CAS # |
|
|
| PubChem CID | 46908026 | |
| Appearance | Off-white to light yellow solid powder | |
| Density | 1.4±0.1 g/cm3 | |
| Boiling Point | 868.6±65.0 °C at 760 mmHg | |
| Flash Point | 479.1±34.3 °C | |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C | |
| Index of Refraction | 1.696 | |
| LogP | 2.95 | |
| Hydrogen Bond Donor Count | 2 | |
| Hydrogen Bond Acceptor Count | 8 | |
| Rotatable Bond Count | 7 | |
| Heavy Atom Count | 45 | |
| Complexity | 1210 | |
| Defined Atom Stereocenter Count | 0 | |
| InChi Key | ZTUJNJAKTLHBEX-UHFFFAOYSA-N | |
| InChi Code | InChI=1S/C35H35FN6O3/c1-39-12-14-41(15-13-39)26-8-9-32(37-19-26)38-30-18-25(20-40(2)34(30)44)27-4-3-5-31(28(27)21-43)42-11-10-23-16-24(22-6-7-22)17-29(36)33(23)35(42)45/h3-5,8-11,16-20,22,43H,6-7,12-15,21H2,1-2H3,(H,37,38) | |
| Chemical Name | 6-cyclopropyl-8-fluoro-2-(2-hydroxymethyl-3-{1-methyl-5-[5-(4-methyl-piperazin-1-yl)-pyridin-2-ylamino]-6-oxo-1,6-dihydro-pyridin-3-yl}-phenyl)-2H-isoquinolin-1-one | |
| Synonyms | RN-486; RN 486; RN486; | |
| HS Tariff Code | 2934.99.9001 | |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
|
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| ln Vitro | Fcγ receptor engagement-mediated tumor necrosis factor α production in monocytes (IC50 = 7 nM), Fcε receptor cross-linking-induced degranulation in mast cells (IC50 = 2.9 nM), and B cell antigen receptor-induced expression of an activation marker, CD69, in B cells in whole blood (IC50 = 21 nM) are all blocked by RN486[1]. Convulxin stimulation led to increased production of pro-inflammatory cytokines, IL-6 and IL-8, in a co-culture system including human primary synovial FLS and activated human platelets. This effect is dose-dependently inhibited by RN486[2]. | ||
| ln Vivo | In rat adjuvant-induced arthritis (AIA) and mouse CIA models, RN486 has strong anti-inflammatory and bone-protective properties. In the AIA model, paw edema and inflammatory markers in the blood are decreased by RN486 (1–30 mg/kg), which also reduces joint and systemic inflammation[1]. | ||
| Animal Protocol |
|
||
| References |
[1]. RN486, a selective Bruton's tyrosine kinase inhibitor, abrogates immune hypersensitivity responses and arthritis in rodents. J Pharmacol Exp Ther. 2012 Apr;341(1):90-103. [2]. Bruton's Tyrosine Kinase mediates platelet receptor-induced generation of microparticles: a potential mechanism for amplification of inflammatory responses in rheumatoid arthritis synovial joints. Immunol Lett. 2013 Feb;150(1-2):97-104. [3]. Suppression of glomerulonephritis in lupus-prone NZB × NZW mice by RN486, a selective inhibitor of Bruton's tyrosine kinase. Arthritis Rheum. 2013 Sep;65(9):2380-91. |
Solubility Data
| Solubility (In Vitro) |
|
|||
| Solubility (In Vivo) |
|
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 1.6483 mL | 8.2414 mL | 16.4829 mL | |
| 5 mM | 0.3297 mL | 1.6483 mL | 3.2966 mL | |
| 10 mM | 0.1648 mL | 0.8241 mL | 1.6483 mL |