Physicochemical Properties
| Molecular Formula | C25H26CL2FN7O3 |
| Molecular Weight | 562.42 |
| CAS # | 346599-65-3 |
| SMILES | CC1=C(NC(=C1)C(=O)NCCN2CCOCC2)C=C3C4=C(NC3=O)N=CN=C4NC5=CC(=C(C=C5)F)Cl.Cl |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| Targets | HER2 |
| References |
[1]. Inhibition of HER-2 by three independent targeting strategies increases paclitaxel resistance of SKOV-3 ovarian carcinoma cells. Naunyn Schmiedebergs Arch Pharmacol. 2005 Feb;371(2):141-51. |
Solubility Data
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 1.7780 mL | 8.8902 mL | 17.7803 mL | |
| 5 mM | 0.3556 mL | 1.7780 mL | 3.5561 mL | |
| 10 mM | 0.1778 mL | 0.8890 mL | 1.7780 mL |