Physicochemical Properties
| Molecular Formula | C19H15NO8 |
| Molecular Weight | 385.324305772781 |
| Exact Mass | 385.079 |
| CAS # | 858128-57-1 |
| PubChem CID | 15950836 |
| Appearance | Light yellow to yellow solid powder |
| LogP | 1.2 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 7 |
| Heavy Atom Count | 28 |
| Complexity | 688 |
| Defined Atom Stereocenter Count | 0 |
| SMILES | O=C1C=CC2C(=C(C3=C(C=2)C=CO3)OCCCC(ON2C(=O)CCC2=O)=O)O1 |
| InChi Key | ZOMXGWWLJXRQKZ-UHFFFAOYSA-N |
| InChi Code | InChI=1S/C19H15NO8/c21-13-4-5-14(22)20(13)28-16(24)2-1-8-25-19-17-12(7-9-26-17)10-11-3-6-15(23)27-18(11)19/h3,6-7,9-10H,1-2,4-5,8H2 |
| Chemical Name | (2,5-dioxopyrrolidin-1-yl) 4-(7-oxofuro[3,2-g]chromen-9-yl)oxybutanoate |
| HS Tariff Code | 2934.99.9001 |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
Solubility Data
| Solubility (In Vitro) | DMSO : 50 mg/mL (129.76 mM) |
| Solubility (In Vivo) |
Solubility in Formulation 1: ≥ 2.5 mg/mL (6.49 mM) (saturation unknown) in 10% DMSO + 90% Corn Oil (add these co-solvents sequentially from left to right, and one by one), clear solution. For example, if 1 mL of working solution is to be prepared, you can add 100 μL of 25.0 mg/mL clear DMSO stock solution to 900 μL of corn oil and mix evenly.  (Please use freshly prepared in vivo formulations for optimal results.) |
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 2.5952 mL | 12.9762 mL | 25.9525 mL | |
| 5 mM | 0.5190 mL | 2.5952 mL | 5.1905 mL | |
| 10 mM | 0.2595 mL | 1.2976 mL | 2.5952 mL |