Physicochemical Properties
| Molecular Formula | C31H38FN5O2 |
| Molecular Weight | 531.66 |
| CAS # | 2863607-73-0 |
| SMILES | [C@H](N1CCC(CC1)C(=O)NCC1C=C(C=C(C=1)NC(N1CCN(CC1)C)=O)F)(C1=CC=CC2C=CC=CC1=2)C |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| References |
[1]. Development of potent and selective inhibitors targeting the papain-like protease of SARS-CoV-2. Cell Chem Biol. 2021;28(6):855-865.e9. |
Solubility Data
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 1.8809 mL | 9.4045 mL | 18.8090 mL | |
| 5 mM | 0.3762 mL | 1.8809 mL | 3.7618 mL | |
| 10 mM | 0.1881 mL | 0.9405 mL | 1.8809 mL |