Physicochemical Properties
| Molecular Formula | C28H40O7 |
| Molecular Weight | 488.61 |
| CAS # | 110267-46-4 |
| SMILES | COC(=O)CCC(C)C1CC(=O)C2(C)C3=C(C(=O)C(O)C12C)C1(C)CCC(O)C(C)(C)C1CC3=O |c:14| |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| References |
[1]. Lucidenic acids P and Q, methyl lucidenate P, and other triterpenoids from the fungus Ganoderma lucidum and their inhibitory effects on Epstein-Barr virus activation. J Nat Prod. 2003 Dec;66(12):1582-5. |
Solubility Data
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 2.0466 mL | 10.2331 mL | 20.4662 mL | |
| 5 mM | 0.4093 mL | 2.0466 mL | 4.0932 mL | |
| 10 mM | 0.2047 mL | 1.0233 mL | 2.0466 mL |