Physicochemical Properties
| Molecular Formula | C15H9CL2FN4 |
| Molecular Weight | 335.163163900375 |
| Exact Mass | 334.018 |
| Elemental Analysis | C, 53.75; H, 2.71; Cl, 21.15; F, 5.67; N, 16.72 |
| CAS # | 2138882-71-8 |
| Related CAS # | 2138882-71-8 |
| PubChem CID | 135338301 |
| Appearance | White to light yellow solid powder |
| LogP | 5.5 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Heavy Atom Count | 22 |
| Complexity | 336 |
| Defined Atom Stereocenter Count | 0 |
| InChi Key | DUROVTLUQOYUPH-UHFFFAOYSA-N |
| InChi Code | InChI=1S/C15H9Cl2FN4/c16-13-20-14(17)22-15(21-13)19-12-7-3-10(4-8-12)9-1-5-11(18)6-2-9/h1-8H,(H,19,20,21,22) |
| Chemical Name | 4,6-dichloro-N-[4-(4-fluorophenyl)phenyl]-1,3,5-triazin-2-amine |
| Synonyms | KEA197; KEA1 97; KEA1-97 |
| HS Tariff Code | 2934.99.9001 |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month Note: This product requires protection from light (avoid light exposure) during transportation and storage. |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| Targets | Caspase 3 (IC50 = 10 μM); Thioredoxin (IC50 = 10 μM) |
| ln Vitro |
KEA1-97 (100 μM; 231MFP cells) impaires thioredoxin pulldown of caspase 3[1]. KEA1-97 (10 μM; 48 hours; 231MFP cells) inhibits the proliferation of 231MFP serum-free cells[1]. KEA1-97 (10 μM; 0~12 hours; 231MFP cells) activates caspase 3/7 and induces apoptotic cell death[1]. KEA1-97 (231MFP cells) is resistant to impairments in survival and proliferation[1]. |
| ln Vivo | KEA1-97 (5 mg/kg; i.p.; 50 days) attenuates tumor xenograft growth[1]. |
| References |
[1]. Chemoproteomics-Enabled Covalent Ligand Screening Reveals a Thioredoxin-Caspase 3 Interaction Disruptor That Impairs Breast Cancer Pathogenicity. ACS Chem Biol. 2017;12(10):2522-2528. |
Solubility Data
| Solubility (In Vitro) | DMSO: ~100 mg/mL (~298.4 mM) |
| Solubility (In Vivo) |
Solubility in Formulation 1: ≥ 2.5 mg/mL (7.46 mM) (saturation unknown) in 10% DMSO + 90% Corn Oil (add these co-solvents sequentially from left to right, and one by one), clear solution. For example, if 1 mL of working solution is to be prepared, you can add 100 μL of 25.0 mg/mL clear DMSO stock solution to 900 μL of corn oil and mix evenly.  (Please use freshly prepared in vivo formulations for optimal results.) |
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 2.9836 mL | 14.9182 mL | 29.8365 mL | |
| 5 mM | 0.5967 mL | 2.9836 mL | 5.9673 mL | |
| 10 mM | 0.2984 mL | 1.4918 mL | 2.9836 mL |