Physicochemical Properties
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.52 |
| CAS # | 125279-79-0 |
| SMILES | O[C@H](COC1=CC=C(NS(=O)(C)=O)C=C1)CNCCOC1=CC=C(N2C=CN=C2)C=C1 |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| References |
[1]. Antifibrillatory efficacy of ersentilide, a novel beta-adrenergic and Ikr blocker, in conscious dogs with a healed myocardial infarction. Cardiovasc Res. 1998 Oct;40(1):56-63. |
Solubility Data
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 2.2395 mL | 11.1977 mL | 22.3954 mL | |
| 5 mM | 0.4479 mL | 2.2395 mL | 4.4791 mL | |
| 10 mM | 0.2240 mL | 1.1198 mL | 2.2395 mL |