Physicochemical Properties
| Molecular Formula | C37H37F2N7O2S |
| Molecular Weight | 681.80 |
| CAS # | 2781912-10-3 |
| SMILES | N(C(C(C1=C2CCC3(CC3)N2C=N1)N1C=C2C(=N1)C(C)=C(C#CC1=CC=C(CN3CCC(CC3)CO)C=C1)C=C2C(F)F)=O)C1SC=CN=1 |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| References |
[1]. Combination of Allosteric and Orthosteric EGFR Inhibitors for Treating Non-Small-Cell Lung Cancer. ACS Med. Chem. Lett. 2024. |
Solubility Data
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 1.4667 mL | 7.3335 mL | 14.6671 mL | |
| 5 mM | 0.2933 mL | 1.4667 mL | 2.9334 mL | |
| 10 mM | 0.1467 mL | 0.7334 mL | 1.4667 mL |