*Note: Please select an appropriate solvent for the preparation of stock solution based on your experiment needs. For most products, DMSO can be used for preparing stock solutions (e.g. 5 mM, 10 mM, or 20 mM concentration); some products with high aqueous solubility may be dissolved in water directly. Solubility information is available at the above Solubility Data section. Once the stock solution is prepared, aliquot it to routine usage volumes and store at -20°C or -80°C. Avoid repeated freeze and thaw cycles.
Physicochemical Properties
| Molecular Formula | C9H19O4P |
| Molecular Weight | 222.2185 |
| Exact Mass | 222.102 |
| CAS # | 36969-89-8 |
| PubChem CID | 580181 |
| Appearance | Typically exists as solid at room temperature |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 316.0±0.0 °C at 760 mmHg |
| Flash Point | 147.6±42.9 °C |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.426 |
| LogP | 1.66 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 8 |
| Heavy Atom Count | 14 |
| Complexity | 207 |
| Defined Atom Stereocenter Count | 0 |
| SMILES | P(C([H])([H])C(C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H])=O)(=O)(OC([H])([H])[H])OC([H])([H])[H] |
| InChi Key | LQZCYXCHWNQBKX-UHFFFAOYSA-N |
| InChi Code | InChI=1S/C9H19O4P/c1-4-5-6-7-9(10)8-14(11,12-2)13-3/h4-8H2,1-3H3 |
| Chemical Name | 1-dimethoxyphosphorylheptan-2-one |
Biological Activity
Solubility Data
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 4.5000 mL | 22.5002 mL | 45.0005 mL | |
| 5 mM | 0.9000 mL | 4.5000 mL | 9.0001 mL | |
| 10 mM | 0.4500 mL | 2.2500 mL | 4.5000 mL |