![Dibenz[c,g]azecin-13(6H)-one,5,7,8,14-tetrahydro-3,4,10,11-tetramethoxy-6-methyl- 2292-20-8](/picture/img/Dibenz[c,g]azecin-13(6H)-one,5,7,8,14-tetrahydro-3,4,10,11-tetramethoxy-6-methyl- Chemical Structure.png)
Physicochemical Properties
| Molecular Formula | C22H27NO5 |
| Exact Mass | 385.189 |
| Elemental Analysis | C, 68.55; H, 7.06; N, 3.63; O, 20.75 |
| CAS # | 2292-20-8 |
| PubChem CID | 288122 |
| Appearance | Solid powder |
| Density | 1.131±0.06 g/cm3(Predicted) |
| Boiling Point | 555.6±50.0 °C(Predicted) |
| Melting Point | 148-150 °C |
| LogP | 3.072 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 4 |
| Heavy Atom Count | 28 |
| Complexity | 515 |
| Defined Atom Stereocenter Count | 0 |
| SMILES | COC1C=C2CCN(CC3C(OC)=C(OC)C=CC=3CC(=O)C2=CC=1OC)C |
| InChi Key | HUIJAZQRYSCNED-UHFFFAOYSA-N |
| InChi Code | InChI=1S/C22H27NO5/c1-23-9-8-15-11-20(26-3)21(27-4)12-16(15)18(24)10-14-6-7-19(25-2)22(28-5)17(14)13-23/h6-7,11-12H,8-10,13H2,1-5H3 |
| Chemical Name | 3,4,10,11-tetramethoxy-6-methyl-5,7,8,14-tetrahydrobenzo[e][2]benzazecin-13-one |
| HS Tariff Code | 2934.99.9001 |
Biological Activity
| Additional Infomation |
Muramine is a dibenzazecine alkaloid that is 5,7,8,14-tetrahydrodibenzo[c,g]azecin-13(6H)-one substituted by a methyl group at position 6 and by methoxy groups at positions 3, 4, 10, and 11. It has a role as a plant metabolite. It is a dibenzazecine alkaloid, a tertiary amino compound and an aromatic ether. Muramine has been reported in Corydalis pallida, Papaver nudicaule, and other organisms with data available. |