Physicochemical Properties
| Molecular Formula | C13H9NO5 |
| Molecular Weight | 259.21 |
| CAS # | 859304-28-2 |
| SMILES | CN1C2=C(C(=O)C=C(C2=O)OC)C(=O)C3=C1OC=C3 |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| References |
[1]. Extensive Biotransformation Profiling of AZD8205, an Anti-B7-H4 Antibody-Drug Conjugate, Elucidates Pathways Underlying Its Stability In Vivo. Anal Chem. 2024 Oct 22;96(42):16525-16533. |
Solubility Data
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 3.8579 mL | 19.2894 mL | 38.5788 mL | |
| 5 mM | 0.7716 mL | 3.8579 mL | 7.7158 mL | |
| 10 mM | 0.3858 mL | 1.9289 mL | 3.8579 mL |