6-Amino-5-azacytidine, an aminated derivative of Azacytidine, is able to inhibit the growth of bacteria E. coli. Azacytidine has been used as an antineoplastic agent. A pyrimidine nucleoside analogue that inhibits DNA methyltransferase, impairing DNA methylation. It is also an antimetabolite of cytidine, incorporated primarily into RNA
Physicochemical Properties
| Molecular Formula | C8H13N5O5 |
| Molecular Weight | 259.219321012497 |
| Exact Mass | 259.091 |
| CAS # | 105331-00-8 |
| PubChem CID | 13630026 |
| Appearance | Typically exists as solid at room temperature |
| LogP | -2.8 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Heavy Atom Count | 18 |
| Complexity | 424 |
| Defined Atom Stereocenter Count | 4 |
| SMILES | C([C@@H]1[C@H]([C@H]([C@@H](O1)N2C(=NC(=NC2=O)N)N)O)O)O |
| InChi Key | HHBIDXKTBPRKSK-TXICZTDVSA-N |
| InChi Code | InChI=1S/C8H13N5O5/c9-6-11-7(10)13(8(17)12-6)5-4(16)3(15)2(1-14)18-5/h2-5,14-16H,1H2,(H4,9,10,11,12,17)/t2-,3-,4-,5-/m1/s1 |
| Chemical Name | 4,6-diamino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| Synonyms | QS4CCV9ZS5 |
| HS Tariff Code | 2934.99.9001 |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| Targets | Anti-bacteria (E. coli) |
| ln Vitro | 6-Amino-5-azacytidine has an ID50 of 33.9 μM against CCRF-CEM cells and inhibits the growth of WI-L2 cells by 39% at 100 μM[1]. |
| References |
[1]. Synthesis, molecular conformation and biological activity of 6-amino-5-azacytidine. Collect. Czech. Chem. Commun. 1989, 54, 2502-2512. |
Solubility Data
| Solubility (In Vitro) | H2O : ~14.71 mg/mL (~56.75 mM) |
| Solubility (In Vivo) |
Solubility in Formulation 1: 8.33 mg/mL (32.13 mM) in PBS (add these co-solvents sequentially from left to right, and one by one), clear solution; with sonication (<60°C). (Please use freshly prepared in vivo formulations for optimal results.) |
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 3.8577 mL | 19.2886 mL | 38.5773 mL | |
| 5 mM | 0.7715 mL | 3.8577 mL | 7.7155 mL | |
| 10 mM | 0.3858 mL | 1.9289 mL | 3.8577 mL |