Physicochemical Properties
| Molecular Formula | C10H13FN2O6 |
| Molecular Weight | 276.22 |
| CAS # | 1613589-04-0 |
| SMILES | F[C@@]1(C([H])([H])O[H])[C@]([H])([C@](C([H])([H])[H])([C@]([H])(N2C([H])=C([H])C(N([H])C2=O)=O)O1)O[H])O[H] |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| References |
[1]. Substituted nucleosides, nucleotides and analogs thereof. WO2014100505. |
Solubility Data
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 3.6203 mL | 18.1015 mL | 36.2030 mL | |
| 5 mM | 0.7241 mL | 3.6203 mL | 7.2406 mL | |
| 10 mM | 0.3620 mL | 1.8102 mL | 3.6203 mL |