Physicochemical Properties
| Molecular Formula | C29H40O9 |
| Molecular Weight | 532.62 |
| CAS # | 852567-75-0 |
| SMILES | CC(=O)OC1C(=O)C2=C(C(=O)CC3C(C)(C)C(O)CCC23C)C2(C)C(=O)CC(C(C)(O)CCC(O)=O)C12C |t:7| |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| References |
[1]. Oxygenated lanostane-type triterpenoids from the fungus Ganoderma l ucidumJ. Journal of Natural Products, 2005, 68(4): 559-563. |
Solubility Data
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 1.8775 mL | 9.3876 mL | 18.7751 mL | |
| 5 mM | 0.3755 mL | 1.8775 mL | 3.7550 mL | |
| 10 mM | 0.1878 mL | 0.9388 mL | 1.8775 mL |