Physicochemical Properties
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 |
| Exact Mass | 178.047 |
| CAS # | 6322-07-2 |
| PubChem CID | 165105 |
| Appearance | Off-white to light yellow solid powder |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 467.9±18.0 °C at 760 mmHg |
| Melting Point | 182-188ºC |
| Flash Point | 201.5±14.7 °C |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Index of Refraction | 1.625 |
| LogP | -3.15 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Heavy Atom Count | 12 |
| Complexity | 181 |
| Defined Atom Stereocenter Count | 4 |
| SMILES | C([C@H]([C@H]1[C@H]([C@H](C(=O)O1)O)O)O)O |
| InChi Key | SXZYCXMUPBBULW-LECHCGJUSA-N |
| InChi Code | InChI=1S/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,7-10H,1H2/t2-,3+,4-,5+/m1/s1 |
| Chemical Name | (3R,4S,5S)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one |
| HS Tariff Code | 2934.99.9001 |
| Storage |
Powder-20°C 3 years 4°C 2 years In solvent -80°C 6 months -20°C 1 month Note: Please store this product in a sealed and protected environment (e.g. under nitrogen), avoid exposure to moisture. |
| Shipping Condition | Room temperature (This product is stable at ambient temperature for a few days during ordinary shipping and time spent in Customs) |
Biological Activity
| Additional Infomation | D-(-)-Gulono-gamma-lactone is a gamma-lactone. |
Solubility Data
| Solubility (In Vitro) | H2O: 250 mg/mL (1403.39 mM) |
| Solubility (In Vivo) |
Solubility in Formulation 1: 50 mg/mL (280.68 mM) in PBS (add these co-solvents sequentially from left to right, and one by one), clear solution; with sonication. (Please use freshly prepared in vivo formulations for optimal results.) |
| Preparing Stock Solutions | 1 mg | 5 mg | 10 mg | |
| 1 mM | 5.6136 mL | 28.0678 mL | 56.1356 mL | |
| 5 mM | 1.1227 mL | 5.6136 mL | 11.2271 mL | |
| 10 mM | 0.5614 mL | 2.8068 mL | 5.6136 mL |